|
There is
another perspective on why we are
having a cancer epidemic ... a
diabetes epidemic, etc. I would like
to share info on why we should
suspect BUTYL or 2-butoxyethanol for
its cause.
You can be exposed second hand, or
get some exposure prior to your
conception, or get too much exposure
by the cleaning, painting that you
do yourself. Exposure looks like the
flu and what is often blamed on a
virus is actually this particular
chemical's poisoning. As a teratogen
chemical it can cause multiple
autoimmune issues and birth defects.
Should be suspect as the primary
chemical of harm to Exxon Valdez oil
spill 'bioremediation' workers ...
the primary harm to Gulf war
Syndrome vets ... even Vietnam Vets
& vets of other wars this past
century
http://www.valdezlink.com/re/andbrainand.htm
Examples
of 'second
hand solvent exposure'
12/6/08 |
| Researchers
just did a study on CFS group "Just
Tired?" or why 'SLEEPY?"
Why
don't researchers and doctors know
what the anemia is?
*
C6H14O2/CH3(CH2)2CH2OCH2CH2OH
causes
|
That would answer their question
with not need of such a study
BUT
there are wrong views in medical
science that prevent doctors from
figuring this out
when there are multiple health issue
changing at the same time
http://www.valdezlink.com/re/worstpesticide.htm
The
Proper View of CFIDS, CFS, FM, ME
more helps to find the fatigue - the
anemia |