http://www.valdezlink.com/larrie_dee.htm
Dear Oil Spill Cleanup Worker,
| This
information is very important
For Women:
C6H14O2/CH3(CH2)2CH2OCH2CH2OH So, I've been asking around and trying to figure out what needs to be checked. Maybe the number of baby red blood cells
in your blood? How many 'grown' red blood cells. How do they
look? A real lab |
|
Recently a man shared that chemicals can cause endocrine disruption ... the glandular systems... the immune system seems all 'whacky' (You can tell I'm not a doctor) It might help to follow the health rules that diabetics follow; but even if someone is diagnosed with diabetes, that might only be one
facet of something larger you are dealing with:
|
|
The blood damage happens first, as I understand it; so it MUST underlie everything else.
That really makes hard for doctors to figure out what's going on when they don't understand that a couple of things are happening at the same time. |
|
I personally believe that Gulf War
Syndrome and too much |
Good food is the best help http://www.valdezlink.com/compromised.htm
- not medications - as that can give a toxic overload... if you have had
too many chemicals, then more chemicals is not helpful; not as it would be
for someone who hadn't had too many chemicals in their system. Avoid
chemicals, and that means alcohol. It is only 'empty' calories and it is
the same family of chemical " ....ohol' that our group of workers
have been
exposed to. Plus it speeds damage to the liver
Can you bring this information to your doctor?
www.valdezlink.com/no_fear.htm I could
make an "A" disc for doctors that
you could give him/her in advance of your appointment. If the doctor will
not cooperate you may need another doctor... but here's hoping that doctors
will be open to considering chemical poisoning issues and helps.
http://www.valdezlink.com/inipol/pages/consultants.htm
Stay on top of eye exams too.
You need the kind that they put drops in your eyes
and
look in the back of your eye.
Maybe see a good ophthalmologist.
You don't want any extra infections to deal with,
so get good dental check ups;
try
not to get the flu, etc.
Do you 'Look Like'
other workers?
Please share your information.
I have some questions for you... so does the Project
What job did you have? What is your health status?
Were
you a 'bioremediation' worker?
Sincerely, Diann Hursh
PO Box 233, Valdez, AK 99686
1-888-853-5333
|
Let's hope this painter wore appropriate personal protective equipment.
2-butoxyethanol harms people who paint, who clean, who work in the plastics & dry cleaning businesses, too
|
June 20, 2003